C6H2N14O12 — CID 137316236
(E)-bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene (PubChem CID 137316236) has the molecular formula C6H2N14O12 and a molecular weight of 462.17 g/mol. Its IUPAC name is (E)-bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene.
| Compound Name | (E)-bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene |
|---|---|
| PubChem CID | 137316236 |
| Molecular Formula | C6H2N14O12 |
| Molecular Weight | 462.17 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | (E)-bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene |
| SMILES | O=[N+]([O-])C(c1nc(/N=N/c2n[nH]c(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n2)n[nH]1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H2N14O12/c21-15(22)5(16(23)24,17(25)26)1-7-3(11-9-1)13-14-4-8-2(10-12-4)6(18(27)28,19(29)30)20(31)32/h(H,7,9,11)(H,8,10,12)/b14-13+ |
| InChIKey | WSSLGAOHQSGIMJ-BUHFOSPRSA-N |
| XLogP | -1.78 |
| TPSA | 366.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.17 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|