C3H2N8O8 — CID 139177769
N-[3-(trinitromethyl)-1H-1,2,4-triazol-5-yl]nitramide (PubChem CID 139177769) has the molecular formula C3H2N8O8 and a molecular weight of 278.10 g/mol. Its IUPAC name is N-[3-(trinitromethyl)-1H-1,2,4-triazol-5-yl]nitramide.
| Compound Name | N-[3-(trinitromethyl)-1H-1,2,4-triazol-5-yl]nitramide |
|---|---|
| PubChem CID | 139177769 |
| Molecular Formula | C3H2N8O8 |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | N-[3-(trinitromethyl)-1H-1,2,4-triazol-5-yl]nitramide |
| SMILES | O=[N+]([O-])Nc1nc(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C3H2N8O8/c12-8(13)3(9(14)15,10(16)17)1-4-2(6-5-1)7-11(18)19/h(H2,4,5,6,7) |
| InChIKey | HYENMPPRXZQQIV-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 226.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|