C4H5N9O2 — CID 172786640
5-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole-1,3-diamine (PubChem CID 172786640) has the molecular formula C4H5N9O2 and a molecular weight of 211.14 g/mol. Its IUPAC name is 5-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole-1,3-diamine.
| Compound Name | 5-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole-1,3-diamine |
|---|---|
| PubChem CID | 172786640 |
| Molecular Formula | C4H5N9O2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 5-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole-1,3-diamine |
| SMILES | Nc1nc(-c2n[nH]c([N+](=O)[O-])n2)n(N)n1 |
| InChI | InChI=1S/C4H5N9O2/c5-3-8-2(12(6)11-3)1-7-4(10-9-1)13(14)15/h6H2,(H2,5,11)(H,7,9,10) |
| InChIKey | NFOOGLOAICFIAO-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|