C4H3N7O8 — CID 134821300
3,5-bis(dinitromethyl)-1H-1,2,4-triazole (PubChem CID 134821300) has the molecular formula C4H3N7O8 and a molecular weight of 277.11 g/mol. Its IUPAC name is 3,5-bis(dinitromethyl)-1H-1,2,4-triazole.
| Compound Name | 3,5-bis(dinitromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 134821300 |
| Molecular Formula | C4H3N7O8 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 3,5-bis(dinitromethyl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])C(c1n[nH]c(C([N+](=O)[O-])[N+](=O)[O-])n1)[N+](=O)[O-] |
| InChI | InChI=1S/C4H3N7O8/c12-8(13)3(9(14)15)1-5-2(7-6-1)4(10(16)17)11(18)19/h3-4H,(H,5,6,7) |
| InChIKey | TYHXOGHRKNITNZ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 214.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|