C4H2F3N5O4 — CID 177402936
5-(dinitromethyl)-3-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 177402936) has the molecular formula C4H2F3N5O4 and a molecular weight of 241.09 g/mol. Its IUPAC name is 5-(dinitromethyl)-3-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 5-(dinitromethyl)-3-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 177402936 |
| Molecular Formula | C4H2F3N5O4 |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 5-(dinitromethyl)-3-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])C(c1nc(C(F)(F)F)n[nH]1)[N+](=O)[O-] |
| InChI | InChI=1S/C4H2F3N5O4/c5-4(6,7)3-8-1(9-10-3)2(11(13)14)12(15)16/h2H,(H,8,9,10) |
| InChIKey | SPJUREDDQPYHIW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|