C4HF3N6O6 — CID 177418142
5-(trifluoromethyl)-3-(trinitromethyl)-1H-1,2,4-triazole (PubChem CID 177418142) has the molecular formula C4HF3N6O6 and a molecular weight of 286.08 g/mol. Its IUPAC name is 5-(trifluoromethyl)-3-(trinitromethyl)-1H-1,2,4-triazole.
| Compound Name | 5-(trifluoromethyl)-3-(trinitromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 177418142 |
| Molecular Formula | C4HF3N6O6 |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 5-(trifluoromethyl)-3-(trinitromethyl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])C(c1n[nH]c(C(F)(F)F)n1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4HF3N6O6/c5-3(6,7)1-8-2(10-9-1)4(11(14)15,12(16)17)13(18)19/h(H,8,9,10) |
| InChIKey | DBPKLQXTOAPUNY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 170.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|