C6H2N12O12 — CID 139178291
5-(trinitromethyl)-3-[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]-1H-1,2,4-triazole (PubChem CID 139178291) has the molecular formula C6H2N12O12 and a molecular weight of 434.15 g/mol. Its IUPAC name is 5-(trinitromethyl)-3-[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]-1H-1,2,4-triazole.
| Compound Name | 5-(trinitromethyl)-3-[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 139178291 |
| Molecular Formula | C6H2N12O12 |
| Molecular Weight | 434.15 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 5-(trinitromethyl)-3-[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])C(c1nc(-c2n[nH]c(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n2)n[nH]1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H2N12O12/c19-13(20)5(14(21)22,15(23)24)3-7-1(9-11-3)2-8-4(12-10-2)6(16(25)26,17(27)28)18(29)30/h(H,7,9,11)(H,8,10,12) |
| InChIKey | HQHGZZLCVHFEFF-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 341.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.15 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|