C3HF3N4O2 — CID 136851281
5-nitro-3-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 136851281) has the molecular formula C3HF3N4O2 and a molecular weight of 182.06 g/mol. Its IUPAC name is 5-nitro-3-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 5-nitro-3-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 136851281 |
| Molecular Formula | C3HF3N4O2 |
| Molecular Weight | 182.06 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 5-nitro-3-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C3HF3N4O2/c4-3(5,6)1-7-2(9-8-1)10(11)12/h(H,7,8,9) |
| InChIKey | BGRVSYFGPCKOJX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.06 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|