C3HF3N6 — CID 135981721
5-azido-3-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 135981721) has the molecular formula C3HF3N6 and a molecular weight of 178.08 g/mol. Its IUPAC name is 5-azido-3-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 5-azido-3-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 135981721 |
| Molecular Formula | C3HF3N6 |
| Molecular Weight | 178.08 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 5-azido-3-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | [N-]=[N+]=Nc1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C3HF3N6/c4-3(5,6)1-8-2(10-9-1)11-12-7/h(H,8,9,10) |
| InChIKey | BVVJUKWWKJTZAQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.08 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|