C3HN8O8- — CID 177468841
nitro-[3-(trinitromethyl)-1H-1,2,4-triazol-5-yl]azanide (PubChem CID 177468841) has the molecular formula C3HN8O8- and a molecular weight of 277.09 g/mol. Its IUPAC name is nitro-[3-(trinitromethyl)-1H-1,2,4-triazol-5-yl]azanide.
| Compound Name | nitro-[3-(trinitromethyl)-1H-1,2,4-triazol-5-yl]azanide |
|---|---|
| PubChem CID | 177468841 |
| Molecular Formula | C3HN8O8- |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | nitro-[3-(trinitromethyl)-1H-1,2,4-triazol-5-yl]azanide |
| SMILES | O=[N+]([O-])[N-]c1nc(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C3HN8O8/c12-8(13)3(9(14)15,10(16)17)1-4-2(6-5-1)7-11(18)19/h(H-,4,5,6,7)/q-1 |
| InChIKey | DVOWEVABBAEAAP-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 228.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|