C4H3N7O8 — CID 156630841
5-nitro-3-(2,2,2-trinitroethyl)-1H-1,2,4-triazole (PubChem CID 156630841) has the molecular formula C4H3N7O8 and a molecular weight of 277.11 g/mol. Its IUPAC name is 5-nitro-3-(2,2,2-trinitroethyl)-1H-1,2,4-triazole.
| Compound Name | 5-nitro-3-(2,2,2-trinitroethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 156630841 |
| Molecular Formula | C4H3N7O8 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 5-nitro-3-(2,2,2-trinitroethyl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C4H3N7O8/c12-8(13)3-5-2(6-7-3)1-4(9(14)15,10(16)17)11(18)19/h1H2,(H,5,6,7) |
| InChIKey | GRNFACJJVORNOQ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 214.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|