C4H6N4O2 — CID 137231810
3-ethyl-5-nitro-1H-1,2,4-triazole (PubChem CID 137231810) has the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. Its IUPAC name is 3-ethyl-5-nitro-1H-1,2,4-triazole.
| Compound Name | 3-ethyl-5-nitro-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 137231810 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 3-ethyl-5-nitro-1H-1,2,4-triazole |
| SMILES | CCc1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C4H6N4O2/c1-2-3-5-4(7-6-3)8(9)10/h2H2,1H3,(H,5,6,7) |
| InChIKey | SQGBWSACLXLKBQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|