C3H8N6O3 — CID 146681445
5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate (PubChem CID 146681445) has the molecular formula C3H8N6O3 and a molecular weight of 176.14 g/mol. Its IUPAC name is 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate.
| Compound Name | 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate |
|---|---|
| PubChem CID | 146681445 |
| Molecular Formula | C3H8N6O3 |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate |
| SMILES | Cc1[nH]nc(N)[n+]1N.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C3H7N5.NO3/c1-2-6-7-3(4)8(2)5;2-1(3)4/h5H2,1H3,(H2,4,7);/q;-1/p+1 |
| InChIKey | FUGYENZEKYQJFD-UHFFFAOYSA-O |
| XLogP | -1.94 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|