5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate

C3H8N6O3 — CID 146681445

IUPAC5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate
SMILESCc1[nH]nc(N)[n+]1N.O=[N+]([O-])[O-]
InChIInChI=1S/C3H7N5.NO3/c1-2-6-7-3(4)8(2)5;2-1(3)4/h5H2,1H3,(H2,4,7);/q;-1/p+1
InChIKeyFUGYENZEKYQJFD-UHFFFAOYSA-O
MW176.14 g/mol
LogP-1.94
Rot. Bonds

About 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate

5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate (PubChem CID 146681445) has the molecular formula C3H8N6O3 and a molecular weight of 176.14 g/mol. Its IUPAC name is 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate.

Molecular Properties

Compound Name5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate
PubChem CID146681445
Molecular FormulaC3H8N6O3
Molecular Weight176.14 g/mol
Exact Mass176.07
IUPAC Name5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate
SMILESCc1[nH]nc(N)[n+]1N.O=[N+]([O-])[O-]
InChIInChI=1S/C3H7N5.NO3/c1-2-6-7-3(4)8(2)5;2-1(3)4/h5H2,1H3,(H2,4,7);/q;-1/p+1
InChIKeyFUGYENZEKYQJFD-UHFFFAOYSA-O
XLogP-1.94
TPSA150.80 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.14
LogP ≤ 5-1.94
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate?
The IUPAC name of 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate (CID 146681445) is 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate.
What is the SMILES notation for 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate?
The canonical SMILES for 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate is Cc1[nH]nc(N)[n+]1N.O=[N+]([O-])[O-].
What is the InChIKey of 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate?
The InChIKey is FUGYENZEKYQJFD-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7N5.NO3/c1-2-6-7-3(4)8(2)5;2-1(3)4/h5H2,1H3,(H2,4,7);/q;-1/p+1.
What are the key properties of 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate?
5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate has a molecular weight of 176.14 g/mol, XLogP of -1.94, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine nitrate is sourced from PubChem (CID 146681445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).