C5H7N7O2 — CID 137128078
3-(1-azidopropyl)-5-nitro-1H-1,2,4-triazole (PubChem CID 137128078) has the molecular formula C5H7N7O2 and a molecular weight of 197.16 g/mol. Its IUPAC name is 3-(1-azidopropyl)-5-nitro-1H-1,2,4-triazole.
| Compound Name | 3-(1-azidopropyl)-5-nitro-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 137128078 |
| Molecular Formula | C5H7N7O2 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-(1-azidopropyl)-5-nitro-1H-1,2,4-triazole |
| SMILES | CCC(N=[N+]=[N-])c1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C5H7N7O2/c1-2-3(8-11-6)4-7-5(10-9-4)12(13)14/h3H,2H2,1H3,(H,7,9,10) |
| InChIKey | XZIHKSBLXRWGST-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|