C4H2N10O4 — CID 177464039
(E)-bis(5-nitro-1H-1,2,4-triazol-3-yl)diazene (PubChem CID 177464039) has the molecular formula C4H2N10O4 and a molecular weight of 254.13 g/mol. Its IUPAC name is (E)-bis(5-nitro-1H-1,2,4-triazol-3-yl)diazene.
| Compound Name | (E)-bis(5-nitro-1H-1,2,4-triazol-3-yl)diazene |
|---|---|
| PubChem CID | 177464039 |
| Molecular Formula | C4H2N10O4 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (E)-bis(5-nitro-1H-1,2,4-triazol-3-yl)diazene |
| SMILES | O=[N+]([O-])c1nc(/N=N/c2n[nH]c([N+](=O)[O-])n2)n[nH]1 |
| InChI | InChI=1S/C4H2N10O4/c15-13(16)3-5-1(9-11-3)7-8-2-6-4(12-10-2)14(17)18/h(H,5,9,11)(H,6,10,12)/b8-7+ |
| InChIKey | ONTREPBSCWLOKI-BQYQJAHWSA-N |
| XLogP | 0.15 |
| TPSA | 194.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|