C4H4N8O2 — CID 71946338
2-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazol-3-amine (PubChem CID 71946338) has the molecular formula C4H4N8O2 and a molecular weight of 196.13 g/mol. Its IUPAC name is 2-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazol-3-amine.
| Compound Name | 2-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 71946338 |
| Molecular Formula | C4H4N8O2 |
| Molecular Weight | 196.13 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncnn1-c1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C4H4N8O2/c5-2-6-1-7-11(2)3-8-4(10-9-3)12(13)14/h1H,(H2,5,6,7)(H,8,9,10) |
| InChIKey | LOCRTBQKUPLING-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.13 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|