C5H4N6O2 — CID 137086508
3-nitro-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 137086508) has the molecular formula C5H4N6O2 and a molecular weight of 180.13 g/mol. Its IUPAC name is 3-nitro-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-nitro-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137086508 |
| Molecular Formula | C5H4N6O2 |
| Molecular Weight | 180.13 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 3-nitro-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2n[nH]c([N+](=O)[O-])c12 |
| InChI | InChI=1S/C5H4N6O2/c6-3-2-4(8-1-7-3)9-10-5(2)11(12)13/h1H,(H3,6,7,8,9,10) |
| InChIKey | LHWPFHIZKZYDMC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.13 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|