About 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine
3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 122381068) has the molecular formula C5H4FN5
and a molecular weight of 153.12 g/mol. Its IUPAC name is 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 122381068 |
| Molecular Formula | C5H4FN5 |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2n[nH]c(F)c12 |
| InChI | InChI=1S/C5H4FN5/c6-3-2-4(7)8-1-9-5(2)11-10-3/h1H,(H3,7,8,9,10,11) |
| InChIKey | YGHLTWPAWVNJLW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine (CID 122381068) is 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine is Nc1ncnc2n[nH]c(F)c12.
What is the InChIKey of 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is YGHLTWPAWVNJLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4FN5/c6-3-2-4(7)8-1-9-5(2)11-10-3/h1H,(H3,7,8,9,10,11).
What are the key properties of 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 153.12 g/mol, XLogP of 0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2H-pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 122381068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).