About 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine
3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 66580326) has the molecular formula C12H9F2N5O
and a molecular weight of 277.23 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 66580326 |
| Molecular Formula | C12H9F2N5O |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1c(F)cc(-c2[nH]nc3ncnc(N)c23)cc1F |
| InChI | InChI=1S/C12H9F2N5O/c1-20-10-6(13)2-5(3-7(10)14)9-8-11(15)16-4-17-12(8)19-18-9/h2-4H,1H3,(H3,15,16,17,18,19) |
| InChIKey | SISLSRRYKSARJQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (CID 66580326) is 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine is COc1c(F)cc(-c2[nH]nc3ncnc(N)c23)cc1F.
What is the InChIKey of 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is SISLSRRYKSARJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2N5O/c1-20-10-6(13)2-5(3-7(10)14)9-8-11(15)16-4-17-12(8)19-18-9/h2-4H,1H3,(H3,15,16,17,18,19).
What are the key properties of 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 277.23 g/mol, XLogP of 1.89, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluoro-4-methoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 66580326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).