C18H15N5O — CID 154131553
3-(2-methyl-4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 154131553) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-(2-methyl-4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(2-methyl-4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154131553 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-(2-methyl-4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1cc(Oc2ccccc2)ccc1-c1[nH]nc2ncnc(N)c12 |
| InChI | InChI=1S/C18H15N5O/c1-11-9-13(24-12-5-3-2-4-6-12)7-8-14(11)16-15-17(19)20-10-21-18(15)23-22-16/h2-10H,1H3,(H3,19,20,21,22,23) |
| InChIKey | GHRZQTZWHDCBNY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |