C29H31N7O2 — CID 144566233
(E)-4-methyl-2-(piperidine-1-carbonyl)pent-2-enenitrile;3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 144566233) has the molecular formula C29H31N7O2 and a molecular weight of 509.61 g/mol. Its IUPAC name is (E)-4-methyl-2-(piperidine-1-carbonyl)pent-2-enenitrile;3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | (E)-4-methyl-2-(piperidine-1-carbonyl)pent-2-enenitrile;3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 144566233 |
| Molecular Formula | C29H31N7O2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | (E)-4-methyl-2-(piperidine-1-carbonyl)pent-2-enenitrile;3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)/C=C(\C#N)C(=O)N1CCCCC1.Nc1ncnc2n[nH]c(-c3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C17H13N5O.C12H18N2O/c18-16-14-15(21-22-17(14)20-10-19-16)11-6-8-13(9-7-11)23-12-4-2-1-3-5-12;1-10(2)8-11(9-13)12(15)14-6-4-3-5-7-14/h1-10H,(H3,18,19,20,21,22);8,10H,3-7H2,1-2H3/b;11-8+ |
| InChIKey | HJYBZMOSSXVCRW-IBMQDACXSA-N |
| XLogP | 5.50 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|