C30H30N6O2 — CID 71015237
2-[(3R)-3-[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]piperidine-1-carbonyl]-4-methylpent-2-enenitrile (PubChem CID 71015237) has the molecular formula C30H30N6O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-[(3R)-3-[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]piperidine-1-carbonyl]-4-methylpent-2-enenitrile.
| Compound Name | 2-[(3R)-3-[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]piperidine-1-carbonyl]-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 71015237 |
| Molecular Formula | C30H30N6O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-[(3R)-3-[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]piperidine-1-carbonyl]-4-methylpent-2-enenitrile |
| SMILES | CC(C)C=C(C#N)C(=O)N1CCC[C@@H](c2cc3[nH]nc(N)c3c(-c3ccc(Oc4ccccc4)cc3)n2)C1 |
| InChI | InChI=1S/C30H30N6O2/c1-19(2)15-22(17-31)30(37)36-14-6-7-21(18-36)25-16-26-27(29(32)35-34-26)28(33-25)20-10-12-24(13-11-20)38-23-8-4-3-5-9-23/h3-5,8-13,15-16,19,21H,6-7,14,18H2,1-2H3,(H3,32,34,35)/t21-/m1/s1 |
| InChIKey | VRFZPGDFGTUTNK-OAQYLSRUSA-N |
| XLogP | 5.81 |
| TPSA | 120.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|