C32H34N6O3 — CID 71015280
(Z)-2-[(2R)-2-[[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]methyl]pyrrolidine-1-carbonyl]-4-ethoxy-4-methylpent-2-enenitrile (PubChem CID 71015280) has the molecular formula C32H34N6O3 and a molecular weight of 550.66 g/mol. Its IUPAC name is (Z)-2-[(2R)-2-[[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]methyl]pyrrolidine-1-carbonyl]-4-ethoxy-4-methylpent-2-enenitrile.
| Compound Name | (Z)-2-[(2R)-2-[[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]methyl]pyrrolidine-1-carbonyl]-4-ethoxy-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 71015280 |
| Molecular Formula | C32H34N6O3 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | (Z)-2-[(2R)-2-[[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]methyl]pyrrolidine-1-carbonyl]-4-ethoxy-4-methylpent-2-enenitrile |
| SMILES | CCOC(C)(C)/C=C(/C#N)C(=O)N1CCC[C@@H]1Cc1cc2[nH]nc(N)c2c(-c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C32H34N6O3/c1-4-40-32(2,3)19-22(20-33)31(39)38-16-8-9-24(38)17-23-18-27-28(30(34)37-36-27)29(35-23)21-12-14-26(15-13-21)41-25-10-6-5-7-11-25/h5-7,10-15,18-19,24H,4,8-9,16-17H2,1-3H3,(H3,34,36,37)/b22-19-/t24-/m1/s1 |
| InChIKey | VCXYALADZYESLT-DOMBRYFRSA-N |
| XLogP | 5.80 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|