C30H32FN7O2 — CID 123738980
2-[2-[[4-amino-3-(2-fluoro-4-phenoxyphenyl)-2,3-dihydropyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile (PubChem CID 123738980) has the molecular formula C30H32FN7O2 and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[2-[[4-amino-3-(2-fluoro-4-phenoxyphenyl)-2,3-dihydropyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile.
| Compound Name | 2-[2-[[4-amino-3-(2-fluoro-4-phenoxyphenyl)-2,3-dihydropyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 123738980 |
| Molecular Formula | C30H32FN7O2 |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 2-[2-[[4-amino-3-(2-fluoro-4-phenoxyphenyl)-2,3-dihydropyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)(C)C=C(C#N)C(=O)N1CCCC1CN1NC(c2ccc(Oc3ccccc3)cc2F)c2c(N)ncnc21 |
| InChI | InChI=1S/C30H32FN7O2/c1-30(2,3)15-19(16-32)29(39)37-13-7-8-20(37)17-38-28-25(27(33)34-18-35-28)26(36-38)23-12-11-22(14-24(23)31)40-21-9-5-4-6-10-21/h4-6,9-12,14-15,18,20,26,36H,7-8,13,17H2,1-3H3,(H2,33,34,35) |
| InChIKey | FJIOLZAEPBMULR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 120.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|