C20H18N6O2 — CID 50996170
2-[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]acetohydrazide (PubChem CID 50996170) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]acetohydrazide.
| Compound Name | 2-[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]acetohydrazide |
|---|---|
| PubChem CID | 50996170 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]acetohydrazide |
| SMILES | NNC(=O)Cc1cc2[nH]nc(N)c2c(-c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C20H18N6O2/c21-20-18-16(25-26-20)10-13(11-17(27)24-22)23-19(18)12-6-8-15(9-7-12)28-14-4-2-1-3-5-14/h1-10H,11,22H2,(H,24,27)(H3,21,25,26) |
| InChIKey | GXDQDTXCNCOALR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|