C25H19N5O2 — CID 89189052
3-[[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]amino]benzaldehyde (PubChem CID 89189052) has the molecular formula C25H19N5O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is 3-[[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]amino]benzaldehyde.
| Compound Name | 3-[[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]amino]benzaldehyde |
|---|---|
| PubChem CID | 89189052 |
| Molecular Formula | C25H19N5O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-[[3-amino-4-(4-phenoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-6-yl]amino]benzaldehyde |
| SMILES | Nc1n[nH]c2cc(Nc3cccc(C=O)c3)nc(-c3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C25H19N5O2/c26-25-23-21(29-30-25)14-22(27-18-6-4-5-16(13-18)15-31)28-24(23)17-9-11-20(12-10-17)32-19-7-2-1-3-8-19/h1-15H,(H,27,28)(H3,26,29,30) |
| InChIKey | JPOQASDINHFGSU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|