C25H20N4O2 — CID 129065794
2-amino-6-(3-formylphenyl)-4-(4-phenoxyphenyl)pyridine-3-carboximidamide (PubChem CID 129065794) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-amino-6-(3-formylphenyl)-4-(4-phenoxyphenyl)pyridine-3-carboximidamide.
| Compound Name | 2-amino-6-(3-formylphenyl)-4-(4-phenoxyphenyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 129065794 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-amino-6-(3-formylphenyl)-4-(4-phenoxyphenyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(-c2ccc(Oc3ccccc3)cc2)cc(-c2cccc(C=O)c2)nc1N |
| InChI | InChI=1S/C25H20N4O2/c26-24(27)23-21(14-22(29-25(23)28)18-6-4-5-16(13-18)15-30)17-9-11-20(12-10-17)31-19-7-2-1-3-8-19/h1-15H,(H3,26,27)(H2,28,29) |
| InChIKey | KOHYQXSCKORNBR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 115.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|