C27H23N5O4 — CID 129083547
2-[[4-[4-amino-5-carbamimidoyl-6-(4-phenoxyphenyl)-2-pyridinyl]benzoyl]amino]acetic acid (PubChem CID 129083547) has the molecular formula C27H23N5O4 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[[4-[4-amino-5-carbamimidoyl-6-(4-phenoxyphenyl)-2-pyridinyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[4-amino-5-carbamimidoyl-6-(4-phenoxyphenyl)-2-pyridinyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 129083547 |
| Molecular Formula | C27H23N5O4 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-[[4-[4-amino-5-carbamimidoyl-6-(4-phenoxyphenyl)-2-pyridinyl]benzoyl]amino]acetic acid |
| SMILES | [H]/N=C(\N)c1c(N)cc(-c2ccc(C(=O)NCC(=O)O)cc2)nc1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H23N5O4/c28-21-14-22(16-6-8-18(9-7-16)27(35)31-15-23(33)34)32-25(24(21)26(29)30)17-10-12-20(13-11-17)36-19-4-2-1-3-5-19/h1-14H,15H2,(H2,28,32)(H3,29,30)(H,31,35)(H,33,34) |
| InChIKey | FJGHBQWUQPBJER-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 164.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|