C22H22N4O3 — CID 129083539
4-[4-amino-5-carbamimidoyl-6-(4-propan-2-yloxyphenyl)-2-pyridinyl]benzoic acid (PubChem CID 129083539) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[4-amino-5-carbamimidoyl-6-(4-propan-2-yloxyphenyl)-2-pyridinyl]benzoic acid.
| Compound Name | 4-[4-amino-5-carbamimidoyl-6-(4-propan-2-yloxyphenyl)-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 129083539 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[4-amino-5-carbamimidoyl-6-(4-propan-2-yloxyphenyl)-2-pyridinyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1c(N)cc(-c2ccc(C(=O)O)cc2)nc1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-12(2)29-16-9-7-14(8-10-16)20-19(21(24)25)17(23)11-18(26-20)13-3-5-15(6-4-13)22(27)28/h3-12H,1-2H3,(H2,23,26)(H3,24,25)(H,27,28) |
| InChIKey | GWBHPTHNJDEAKX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 135.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|