C30H24N4O2 — CID 129083628
4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide (PubChem CID 129083628) has the molecular formula C30H24N4O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide.
| Compound Name | 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 129083628 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N)cc(-c2ccc(Oc3ccccc3)cc2)nc1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N4O2/c31-26-19-27(20-11-15-24(16-12-20)35-22-7-3-1-4-8-22)34-29(28(26)30(32)33)21-13-17-25(18-14-21)36-23-9-5-2-6-10-23/h1-19H,(H2,31,34)(H3,32,33) |
| InChIKey | YGRZLEPLJGBUHN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|