About 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide
4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide (PubChem CID 129083628) has the molecular formula C30H24N4O2
and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide |
| PubChem CID | 129083628 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N)cc(-c2ccc(Oc3ccccc3)cc2)nc1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N4O2/c31-26-19-27(20-11-15-24(16-12-20)35-22-7-3-1-4-8-22)34-29(28(26)30(32)33)21-13-17-25(18-14-21)36-23-9-5-2-6-10-23/h1-19H,(H2,31,34)(H3,32,33) |
| InChIKey | YGRZLEPLJGBUHN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide?
The IUPAC name of 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide (CID 129083628) is 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide.
What is the SMILES notation for 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide?
The canonical SMILES for 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide is [H]/N=C(\N)c1c(N)cc(-c2ccc(Oc3ccccc3)cc2)nc1-c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide?
The InChIKey is YGRZLEPLJGBUHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24N4O2/c31-26-19-27(20-11-15-24(16-12-20)35-22-7-3-1-4-8-22)34-29(28(26)30(32)33)21-13-17-25(18-14-21)36-23-9-5-2-6-10-23/h1-19H,(H2,31,34)(H3,32,33).
What are the key properties of 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide?
4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide has a molecular weight of 472.55 g/mol, XLogP of 6.87, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-bis(4-phenoxyphenyl)pyridine-3-carboximidamide is sourced from PubChem (CID 129083628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).