C24H27N5O2 — CID 129083727
4-amino-6-[3-(hydroxymethyl)piperidin-1-yl]-2-(4-phenoxyphenyl)pyridine-3-carboximidamide (PubChem CID 129083727) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-amino-6-[3-(hydroxymethyl)piperidin-1-yl]-2-(4-phenoxyphenyl)pyridine-3-carboximidamide.
| Compound Name | 4-amino-6-[3-(hydroxymethyl)piperidin-1-yl]-2-(4-phenoxyphenyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 129083727 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-amino-6-[3-(hydroxymethyl)piperidin-1-yl]-2-(4-phenoxyphenyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N)cc(N2CCCC(CO)C2)nc1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N5O2/c25-20-13-21(29-12-4-5-16(14-29)15-30)28-23(22(20)24(26)27)17-8-10-19(11-9-17)31-18-6-2-1-3-7-18/h1-3,6-11,13,16,30H,4-5,12,14-15H2,(H2,25,28)(H3,26,27) |
| InChIKey | RXRUCXAPFAOULB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|