C30H24N4O — CID 129083484
3-amino-5-(4-phenoxyphenyl)-2-(4-phenylphenyl)pyridine-4-carboximidamide (PubChem CID 129083484) has the molecular formula C30H24N4O and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-amino-5-(4-phenoxyphenyl)-2-(4-phenylphenyl)pyridine-4-carboximidamide.
| Compound Name | 3-amino-5-(4-phenoxyphenyl)-2-(4-phenylphenyl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 129083484 |
| Molecular Formula | C30H24N4O |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-amino-5-(4-phenoxyphenyl)-2-(4-phenylphenyl)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(-c2ccc(Oc3ccccc3)cc2)cnc(-c2ccc(-c3ccccc3)cc2)c1N |
| InChI | InChI=1S/C30H24N4O/c31-28-27(30(32)33)26(22-15-17-25(18-16-22)35-24-9-5-2-6-10-24)19-34-29(28)23-13-11-21(12-14-23)20-7-3-1-4-8-20/h1-19H,31H2,(H3,32,33) |
| InChIKey | INSKVRQZTAAOAN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|