C27H25N5O2 — CID 129083554
3-[4-amino-5-carbamimidoyl-6-(4-phenoxyphenyl)-3-pyridinyl]-N,N-dimethylbenzamide (PubChem CID 129083554) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-[4-amino-5-carbamimidoyl-6-(4-phenoxyphenyl)-3-pyridinyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[4-amino-5-carbamimidoyl-6-(4-phenoxyphenyl)-3-pyridinyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 129083554 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 3-[4-amino-5-carbamimidoyl-6-(4-phenoxyphenyl)-3-pyridinyl]-N,N-dimethylbenzamide |
| SMILES | [H]/N=C(\N)c1c(-c2ccc(Oc3ccccc3)cc2)ncc(-c2cccc(C(=O)N(C)C)c2)c1N |
| InChI | InChI=1S/C27H25N5O2/c1-32(2)27(33)19-8-6-7-18(15-19)22-16-31-25(23(24(22)28)26(29)30)17-11-13-21(14-12-17)34-20-9-4-3-5-10-20/h3-16H,1-2H3,(H2,28,31)(H3,29,30) |
| InChIKey | YDOGGARCXLMCSP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|