C23H25N5O2 — CID 129083354
4-amino-6-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-(4-phenoxyphenyl)pyridine-3-carboximidamide (PubChem CID 129083354) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-amino-6-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-(4-phenoxyphenyl)pyridine-3-carboximidamide.
| Compound Name | 4-amino-6-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-(4-phenoxyphenyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 129083354 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-amino-6-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-(4-phenoxyphenyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N)cc(N2CCCC2CO)nc1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N5O2/c24-19-13-20(28-12-4-5-16(28)14-29)27-22(21(19)23(25)26)15-8-10-18(11-9-15)30-17-6-2-1-3-7-17/h1-3,6-11,13,16,29H,4-5,12,14H2,(H2,24,27)(H3,25,26) |
| InChIKey | GKAJUOHBINAPTM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|