C33H29N7O2 — CID 71245599
3-[3-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 71245599) has the molecular formula C33H29N7O2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 3-[3-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[3-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 71245599 |
| Molecular Formula | C33H29N7O2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 3-[3-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | CN1CCN(C(=O)C(C#N)=Cc2cccc(-n3cc(-c4ccc(Oc5ccccc5)cc4)c4c(N)ncnc43)c2)CC1 |
| InChI | InChI=1S/C33H29N7O2/c1-38-14-16-39(17-15-38)33(41)25(20-34)18-23-6-5-7-26(19-23)40-21-29(30-31(35)36-22-37-32(30)40)24-10-12-28(13-11-24)42-27-8-3-2-4-9-27/h2-13,18-19,21-22H,14-17H2,1H3,(H2,35,36,37) |
| InChIKey | PJJDXQKWWRVKRB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|