About 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine
3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 22145336) has the molecular formula C8H7N5
and a molecular weight of 173.18 g/mol. Its IUPAC name is 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 22145336 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC#Cc1[nH]nc2ncnc(N)c12 |
| InChI | InChI=1S/C8H7N5/c1-2-3-5-6-7(9)10-4-11-8(6)13-12-5/h4H,1H3,(H3,9,10,11,12,13) |
| InChIKey | GVOMFFYDGFXDHE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine (CID 22145336) is 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine is CC#Cc1[nH]nc2ncnc(N)c12.
What is the InChIKey of 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is GVOMFFYDGFXDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5/c1-2-3-5-6-7(9)10-4-11-8(6)13-12-5/h4H,1H3,(H3,9,10,11,12,13).
What are the key properties of 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 173.18 g/mol, XLogP of 0.31, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-1-ynyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 22145336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).