About 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine
3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 89154211) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 89154211 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCc1[nH]nc2ncnc(N)c12 |
| InChI | InChI=1S/C7H9N5/c1-2-4-5-6(8)9-3-10-7(5)12-11-4/h3H,2H2,1H3,(H3,8,9,10,11,12) |
| InChIKey | MYOSJPRSRNFNSQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine (CID 89154211) is 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine is CCc1[nH]nc2ncnc(N)c12.
What is the InChIKey of 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is MYOSJPRSRNFNSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-2-4-5-6(8)9-3-10-7(5)12-11-4/h3H,2H2,1H3,(H3,8,9,10,11,12).
What are the key properties of 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 163.18 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2H-pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 89154211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).