About 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine
3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine (PubChem CID 135582783) has the molecular formula C4H4N6O2
and a molecular weight of 168.12 g/mol. Its IUPAC name is 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine.
Molecular Properties
| Compound Name | 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine |
| PubChem CID | 135582783 |
| Molecular Formula | C4H4N6O2 |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine |
| SMILES | Nc1n[nH]c2c([N+](=O)[O-])[nH]nc12 |
| InChI | InChI=1S/C4H4N6O2/c5-3-1-2(7-8-3)4(9-6-1)10(11)12/h(H,6,9)(H3,5,7,8) |
| InChIKey | INYFZVREYBICLW-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine?
The IUPAC name of 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine (CID 135582783) is 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine.
What is the SMILES notation for 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine?
The canonical SMILES for 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine is Nc1n[nH]c2c([N+](=O)[O-])[nH]nc12.
What is the InChIKey of 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine?
The InChIKey is INYFZVREYBICLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N6O2/c5-3-1-2(7-8-3)4(9-6-1)10(11)12/h(H,6,9)(H3,5,7,8).
What are the key properties of 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine?
3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine has a molecular weight of 168.12 g/mol, XLogP of -0.22, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine is sourced from PubChem (CID 135582783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).