C4H4N6O2 — CID 135582783
3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine (PubChem CID 135582783) has the molecular formula C4H4N6O2 and a molecular weight of 168.12 g/mol. Its IUPAC name is 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine.
| Compound Name | 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine |
|---|---|
| PubChem CID | 135582783 |
| Molecular Formula | C4H4N6O2 |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 3-nitro-2,4-dihydropyrazolo[4,3-c]pyrazol-6-amine |
| SMILES | Nc1n[nH]c2c([N+](=O)[O-])[nH]nc12 |
| InChI | InChI=1S/C4H4N6O2/c5-3-1-2(7-8-3)4(9-6-1)10(11)12/h(H,6,9)(H3,5,7,8) |
| InChIKey | INYFZVREYBICLW-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|