C6H4N8O9 — CID 139179043
4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole;hydrate (PubChem CID 139179043) has the molecular formula C6H4N8O9 and a molecular weight of 332.15 g/mol. Its IUPAC name is 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole;hydrate.
| Compound Name | 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole;hydrate |
|---|---|
| PubChem CID | 139179043 |
| Molecular Formula | C6H4N8O9 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole;hydrate |
| SMILES | O.O=[N+]([O-])c1n[nH]c([N+](=O)[O-])c1-c1c([N+](=O)[O-])n[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H2N8O8.H2O/c15-11(16)3-1(4(8-7-3)12(17)18)2-5(13(19)20)9-10-6(2)14(21)22;/h(H,7,8)(H,9,10);1H2 |
| InChIKey | QKHFVIVIYPYDKC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 261.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|