C3HBr2N3O2 — CID 135563619
3,4-dibromo-5-nitro-1H-pyrazole (PubChem CID 135563619) has the molecular formula C3HBr2N3O2 and a molecular weight of 270.87 g/mol. Its IUPAC name is 3,4-dibromo-5-nitro-1H-pyrazole.
| Compound Name | 3,4-dibromo-5-nitro-1H-pyrazole |
|---|---|
| PubChem CID | 135563619 |
| Molecular Formula | C3HBr2N3O2 |
| Molecular Weight | 270.87 g/mol |
| Exact Mass | 268.84 |
| IUPAC Name | 3,4-dibromo-5-nitro-1H-pyrazole |
| SMILES | O=[N+]([O-])c1[nH]nc(Br)c1Br |
| InChI | InChI=1S/C3HBr2N3O2/c4-1-2(5)6-7-3(1)8(9)10/h(H,6,7) |
| InChIKey | OXDUHJKOCRBBCW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.87 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|