C14H10BrClN6O3 — CID 135829892
4-bromo-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135829892) has the molecular formula C14H10BrClN6O3 and a molecular weight of 425.63 g/mol. Its IUPAC name is 4-bromo-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135829892 |
| Molecular Formula | C14H10BrClN6O3 |
| Molecular Weight | 425.63 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 4-bromo-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(Cl)cc2)n1)c1n[nH]c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C14H10BrClN6O3/c15-11-12(18-19-13(11)22(24)25)14(23)17-10-5-6-21(20-10)7-8-1-3-9(16)4-2-8/h1-6H,7H2,(H,18,19)(H,17,20,23) |
| InChIKey | WZBGQKLJDGTKKV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|