C14H12N6O3 — CID 135770931
N-(1-benzylpyrazol-3-yl)-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135770931) has the molecular formula C14H12N6O3 and a molecular weight of 312.29 g/mol. Its IUPAC name is N-(1-benzylpyrazol-3-yl)-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-(1-benzylpyrazol-3-yl)-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135770931 |
| Molecular Formula | C14H12N6O3 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(1-benzylpyrazol-3-yl)-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2ccccc2)n1)c1cc([N+](=O)[O-])[nH]n1 |
| InChI | InChI=1S/C14H12N6O3/c21-14(11-8-13(17-16-11)20(22)23)15-12-6-7-19(18-12)9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17)(H,15,18,21) |
| InChIKey | RCPVCRLWDUGVPA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|