C14H15ClN6O3 — CID 78207769
N-(1-benzylpyrazol-3-yl)-4-chloro-5-nitropyrazolidine-3-carboxamide (PubChem CID 78207769) has the molecular formula C14H15ClN6O3 and a molecular weight of 350.77 g/mol. Its IUPAC name is N-(1-benzylpyrazol-3-yl)-4-chloro-5-nitropyrazolidine-3-carboxamide.
| Compound Name | N-(1-benzylpyrazol-3-yl)-4-chloro-5-nitropyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 78207769 |
| Molecular Formula | C14H15ClN6O3 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(1-benzylpyrazol-3-yl)-4-chloro-5-nitropyrazolidine-3-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2ccccc2)n1)C1NNC([N+](=O)[O-])C1Cl |
| InChI | InChI=1S/C14H15ClN6O3/c15-11-12(17-18-13(11)21(23)24)14(22)16-10-6-7-20(19-10)8-9-4-2-1-3-5-9/h1-7,11-13,17-18H,8H2,(H,16,19,22) |
| InChIKey | YKKVZRVAYLRASZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|