C10H4Br3N5O5 — CID 135829909
4-bromo-N-(2,6-dibromo-4-nitrophenyl)-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135829909) has the molecular formula C10H4Br3N5O5 and a molecular weight of 513.88 g/mol. Its IUPAC name is 4-bromo-N-(2,6-dibromo-4-nitrophenyl)-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-(2,6-dibromo-4-nitrophenyl)-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135829909 |
| Molecular Formula | C10H4Br3N5O5 |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 510.78 |
| IUPAC Name | 4-bromo-N-(2,6-dibromo-4-nitrophenyl)-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1c(Br)cc([N+](=O)[O-])cc1Br)c1n[nH]c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C10H4Br3N5O5/c11-4-1-3(17(20)21)2-5(12)7(4)14-10(19)8-6(13)9(16-15-8)18(22)23/h1-2H,(H,14,19)(H,15,16) |
| InChIKey | GKGDJFLTDNZSQP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|