C16H9Br2ClN4O3 — CID 19509329
3-(4-chlorophenyl)-N-(2,6-dibromo-4-nitrophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19509329) has the molecular formula C16H9Br2ClN4O3 and a molecular weight of 500.53 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2,6-dibromo-4-nitrophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-(2,6-dibromo-4-nitrophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19509329 |
| Molecular Formula | C16H9Br2ClN4O3 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 497.87 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2,6-dibromo-4-nitrophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1c(Br)cc([N+](=O)[O-])cc1Br)c1cc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C16H9Br2ClN4O3/c17-11-5-10(23(25)26)6-12(18)15(11)20-16(24)14-7-13(21-22-14)8-1-3-9(19)4-2-8/h1-7H,(H,20,24)(H,21,22) |
| InChIKey | PZSDSDRWULJGHB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|