C23H14Cl2F2N4O5 — CID 19514240
N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3-[4-(difluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 19514240) has the molecular formula C23H14Cl2F2N4O5 and a molecular weight of 535.29 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3-[4-(difluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3-[4-(difluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19514240 |
| Molecular Formula | C23H14Cl2F2N4O5 |
| Molecular Weight | 535.29 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3-[4-(difluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cc(Oc2ccc(Cl)cc2Cl)cc([N+](=O)[O-])c1)c1cc(-c2ccc(OC(F)F)cc2)n[nH]1 |
| InChI | InChI=1S/C23H14Cl2F2N4O5/c24-13-3-6-21(18(25)7-13)35-17-9-14(8-15(10-17)31(33)34)28-22(32)20-11-19(29-30-20)12-1-4-16(5-2-12)36-23(26)27/h1-11,23H,(H,28,32)(H,29,30) |
| InChIKey | IFSLKAMIKVKMQS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.29 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|