C23H15Cl3N4O4 — CID 19513624
N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19513624) has the molecular formula C23H15Cl3N4O4 and a molecular weight of 517.76 g/mol. Its IUPAC name is N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19513624 |
| Molecular Formula | C23H15Cl3N4O4 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-3-(3,4-dichlorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cc(Oc2cc(NC(=O)c3cc(-c4ccc(Cl)c(Cl)c4)n[nH]3)cc([N+](=O)[O-])c2)ccc1Cl |
| InChI | InChI=1S/C23H15Cl3N4O4/c1-12-6-16(3-5-18(12)24)34-17-9-14(8-15(10-17)30(32)33)27-23(31)22-11-21(28-29-22)13-2-4-19(25)20(26)7-13/h2-11H,1H3,(H,27,31)(H,28,29) |
| InChIKey | MMSILAOFMNRUKU-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|