C17H11BrClN5O6 — CID 135803332
4-bromo-N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135803332) has the molecular formula C17H11BrClN5O6 and a molecular weight of 496.66 g/mol. Its IUPAC name is 4-bromo-N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803332 |
| Molecular Formula | C17H11BrClN5O6 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 494.96 |
| IUPAC Name | 4-bromo-N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(Oc2cc(NC(=O)c3n[nH]c([N+](=O)[O-])c3Br)cc([N+](=O)[O-])c2)ccc1Cl |
| InChI | InChI=1S/C17H11BrClN5O6/c1-8-4-11(2-3-13(8)19)30-12-6-9(5-10(7-12)23(26)27)20-17(25)15-14(18)16(22-21-15)24(28)29/h2-7H,1H3,(H,20,25)(H,21,22) |
| InChIKey | WISLANGOSSYNCH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|