C17H11Cl2N5O7 — CID 19511015
N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19511015) has the molecular formula C17H11Cl2N5O7 and a molecular weight of 468.21 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19511015 |
| Molecular Formula | C17H11Cl2N5O7 |
| Molecular Weight | 468.21 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | COc1n[nH]c(C(=O)Nc2cc(Oc3ccc(Cl)cc3Cl)cc([N+](=O)[O-])c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11Cl2N5O7/c1-30-17-15(24(28)29)14(21-22-17)16(25)20-9-5-10(23(26)27)7-11(6-9)31-13-3-2-8(18)4-12(13)19/h2-7H,1H3,(H,20,25)(H,21,22) |
| InChIKey | YTWWUDMFAHNNGP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 162.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|