C11H8ClN5O6 — CID 19510945
N-(4-chloro-2-nitrophenyl)-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19510945) has the molecular formula C11H8ClN5O6 and a molecular weight of 341.67 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19510945 |
| Molecular Formula | C11H8ClN5O6 |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-3-methoxy-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | COc1n[nH]c(C(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8ClN5O6/c1-23-11-9(17(21)22)8(14-15-11)10(18)13-6-3-2-5(12)4-7(6)16(19)20/h2-4H,1H3,(H,13,18)(H,14,15) |
| InChIKey | OIDBUOHPYDHTJB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|